C11H19NO — CID 788016
4-[(2R)-pyrrolidin-2-yl]hepta-1,6-dien-4-ol (PubChem CID 788016) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-[(2R)-pyrrolidin-2-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[(2R)-pyrrolidin-2-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 788016 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-[(2R)-pyrrolidin-2-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)[C@H]1CCCN1 |
| InChI | InChI=1S/C11H19NO/c1-3-7-11(13,8-4-2)10-6-5-9-12-10/h3-4,10,12-13H,1-2,5-9H2/t10-/m1/s1 |
| InChIKey | GVRIOVVQHOPRJB-SNVBAGLBSA-N |
| XLogP | 1.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|