C14H20N2OS — CID 78801873
(2-methylcyclopropyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 78801873) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is (2-methylcyclopropyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (2-methylcyclopropyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 78801873 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (2-methylcyclopropyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | CC1CC1C(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C14H20N2OS/c1-11-9-13(11)14(17)16-6-4-15(5-7-16)10-12-3-2-8-18-12/h2-3,8,11,13H,4-7,9-10H2,1H3 |
| InChIKey | MMMSRZDSBOEFIS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |