C22H16N2O2 — CID 78802824
1-oxo-N-(2-phenylphenyl)-2H-isoquinoline-3-carboxamide (PubChem CID 78802824) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-oxo-N-(2-phenylphenyl)-2H-isoquinoline-3-carboxamide.
| Compound Name | 1-oxo-N-(2-phenylphenyl)-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 78802824 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-oxo-N-(2-phenylphenyl)-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H16N2O2/c25-21-18-12-5-4-10-16(18)14-20(24-21)22(26)23-19-13-7-6-11-17(19)15-8-2-1-3-9-15/h1-14H,(H,23,26)(H,24,25) |
| InChIKey | KZKGRVFXJCHJRJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |