C21H22F2N4O3 — CID 78806598
4-(difluoromethoxy)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-methoxybenzamide (PubChem CID 78806598) has the molecular formula C21H22F2N4O3 and a molecular weight of 416.43 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 78806598 |
| Molecular Formula | C21H22F2N4O3 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccnn2Cc2ccc(N(C)C)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H22F2N4O3/c1-26(2)16-7-4-14(5-8-16)13-27-19(10-11-24-27)25-20(28)15-6-9-17(30-21(22)23)18(12-15)29-3/h4-12,21H,13H2,1-3H3,(H,25,28) |
| InChIKey | CFBPOKOWUCGXKC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|