C21H25N5O4 — CID 78808972
5-methyl-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]-2-pyrrol-1-ylfuran-3-carbonitrile (PubChem CID 78808972) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 5-methyl-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]-2-pyrrol-1-ylfuran-3-carbonitrile.
| Compound Name | 5-methyl-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]-2-pyrrol-1-ylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 78808972 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 5-methyl-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]-2-pyrrol-1-ylfuran-3-carbonitrile |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)N1CCN(CC(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C21H25N5O4/c1-16-19(17(14-22)21(30-16)26-4-2-3-5-26)20(28)25-8-6-23(7-9-25)15-18(27)24-10-12-29-13-11-24/h2-5H,6-13,15H2,1H3 |
| InChIKey | NUXAMNJMIUZLJT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|