C20H24N4O4 — CID 86916941
tert-butyl 4-(4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carbonyl)piperazine-1-carboxylate (PubChem CID 86916941) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl 4-(4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86916941 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | tert-butyl 4-(4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carbonyl)piperazine-1-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H24N4O4/c1-14-16(15(13-21)18(27-14)23-7-5-6-8-23)17(25)22-9-11-24(12-10-22)19(26)28-20(2,3)4/h5-8H,9-12H2,1-4H3 |
| InChIKey | KWHCPKBYPJQYBY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|