C20H19N5O3 — CID 86915806
4-cyano-2-methyl-N'-[2-(4-methylanilino)acetyl]-5-pyrrol-1-ylfuran-3-carbohydrazide (PubChem CID 86915806) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is 4-cyano-2-methyl-N'-[2-(4-methylanilino)acetyl]-5-pyrrol-1-ylfuran-3-carbohydrazide.
| Compound Name | 4-cyano-2-methyl-N'-[2-(4-methylanilino)acetyl]-5-pyrrol-1-ylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 86915806 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-cyano-2-methyl-N'-[2-(4-methylanilino)acetyl]-5-pyrrol-1-ylfuran-3-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2c(C)oc(-n3cccc3)c2C#N)cc1 |
| InChI | InChI=1S/C20H19N5O3/c1-13-5-7-15(8-6-13)22-12-17(26)23-24-19(27)18-14(2)28-20(16(18)11-21)25-9-3-4-10-25/h3-10,22H,12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | VEQVADZSTPVHFN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|