C20H23N3O4 — CID 8782648
[2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 8782648) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8782648 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCC(=O)N[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C20H23N3O4/c1-13-7-3-4-8-16(13)22-17(24)12-26-20(25)18-14(2)27-19(15(18)11-21)23-9-5-6-10-23/h5-6,9-10,13,16H,3-4,7-8,12H2,1-2H3,(H,22,24)/t13-,16-/m0/s1 |
| InChIKey | NQEJZKLDAHYTRO-BBRMVZONSA-N |
| XLogP | 3.10 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|