C18H19N3O5 — CID 8782526
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 8782526) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8782526 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H19N3O5/c1-12-16(14(9-19)17(26-12)21-6-2-3-7-21)18(23)25-11-15(22)20-10-13-5-4-8-24-13/h2-3,6-7,13H,4-5,8,10-11H2,1H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | MPVISDSQGRWMHI-CYBMUJFWSA-N |
| XLogP | 1.70 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|