C21H25N3O4 — CID 11933214
[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate (PubChem CID 11933214) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate.
| Compound Name | [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
|---|---|
| PubChem CID | 11933214 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-cyano-2-methyl-5-pyrrol-1-ylfuran-3-carboxylate |
| SMILES | Cc1oc(-n2cccc2)c(C#N)c1C(=O)OCC(=O)N[C@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C21H25N3O4/c1-13-7-6-8-17(14(13)2)23-18(25)12-27-21(26)19-15(3)28-20(16(19)11-22)24-9-4-5-10-24/h4-5,9-10,13-14,17H,6-8,12H2,1-3H3,(H,23,25)/t13-,14+,17+/m1/s1 |
| InChIKey | MAOLARQPGYARAH-KEYYUXOJSA-N |
| XLogP | 3.35 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|