C16H21N3O3S — CID 78811549
N-[1-(1-benzofuran-2-yl)ethyl]-2-(carbamoylamino)-4-methylsulfanylbutanamide (PubChem CID 78811549) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-2-(carbamoylamino)-4-methylsulfanylbutanamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-2-(carbamoylamino)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 78811549 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-2-(carbamoylamino)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NC(N)=O)C(=O)NC(C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H21N3O3S/c1-10(14-9-11-5-3-4-6-13(11)22-14)18-15(20)12(7-8-23-2)19-16(17)21/h3-6,9-10,12H,7-8H2,1-2H3,(H,18,20)(H3,17,19,21) |
| InChIKey | VZHXFMXJYTVTHS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |