C15H21BrN2O3 — CID 78812720
2-[[2-(4-bromophenoxy)acetyl]-methylamino]-N,N-diethylacetamide (PubChem CID 78812720) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[[2-(4-bromophenoxy)acetyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[2-(4-bromophenoxy)acetyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 78812720 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[[2-(4-bromophenoxy)acetyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-4-18(5-2)14(19)10-17(3)15(20)11-21-13-8-6-12(16)7-9-13/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | FQJCKBHPPUAMRM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |