C21H24N2O4 — CID 9229917
2-[(2-dibenzofuran-2-yloxyacetyl)-methylamino]-N,N-diethylacetamide (PubChem CID 9229917) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[(2-dibenzofuran-2-yloxyacetyl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(2-dibenzofuran-2-yloxyacetyl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 9229917 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[(2-dibenzofuran-2-yloxyacetyl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)COc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C21H24N2O4/c1-4-23(5-2)20(24)13-22(3)21(25)14-26-15-10-11-19-17(12-15)16-8-6-7-9-18(16)27-19/h6-12H,4-5,13-14H2,1-3H3 |
| InChIKey | CUCPKXCKHHNFFI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |