About (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate
(3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 78814618) has the molecular formula C17H18FNO3S
and a molecular weight of 335.40 g/mol. Its IUPAC name is (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 78814618 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC1CCCC(OC(=O)c2csc(-c3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C17H18FNO3S/c1-21-13-3-2-4-14(9-13)22-17(20)15-10-23-16(19-15)11-5-7-12(18)8-6-11/h5-8,10,13-14H,2-4,9H2,1H3 |
| InChIKey | XIHVQZXJGVGKEE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (CID 78814618) is (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate is COC1CCCC(OC(=O)c2csc(-c3ccc(F)cc3)n2)C1.
What is the InChIKey of (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is XIHVQZXJGVGKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO3S/c1-21-13-3-2-4-14(9-13)22-17(20)15-10-23-16(19-15)11-5-7-12(18)8-6-11/h5-8,10,13-14H,2-4,9H2,1H3.
What are the key properties of (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate?
(3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 335.40 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxycyclohexyl) 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 78814618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).