C24H31N3O3 — CID 78816437
1-butyl-2-(2-methoxyphenyl)-6-oxo-N-(1-pyridin-4-ylethyl)piperidine-3-carboxamide (PubChem CID 78816437) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-butyl-2-(2-methoxyphenyl)-6-oxo-N-(1-pyridin-4-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-butyl-2-(2-methoxyphenyl)-6-oxo-N-(1-pyridin-4-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 78816437 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-butyl-2-(2-methoxyphenyl)-6-oxo-N-(1-pyridin-4-ylethyl)piperidine-3-carboxamide |
| SMILES | CCCCN1C(=O)CCC(C(=O)NC(C)c2ccncc2)C1c1ccccc1OC |
| InChI | InChI=1S/C24H31N3O3/c1-4-5-16-27-22(28)11-10-20(23(27)19-8-6-7-9-21(19)30-3)24(29)26-17(2)18-12-14-25-15-13-18/h6-9,12-15,17,20,23H,4-5,10-11,16H2,1-3H3,(H,26,29) |
| InChIKey | ZNQZIACTQUIIKI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |