C23H26N4O2S — CID 78817814
3-(2,3-dimethylphenyl)-7-(4-methyl-1,4-diazepane-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 78817814) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-7-(4-methyl-1,4-diazepane-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(2,3-dimethylphenyl)-7-(4-methyl-1,4-diazepane-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 78817814 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-7-(4-methyl-1,4-diazepane-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | Cc1cccc(-n2c(=S)[nH]c3cc(C(=O)N4CCCN(C)CC4)ccc3c2=O)c1C |
| InChI | InChI=1S/C23H26N4O2S/c1-15-6-4-7-20(16(15)2)27-22(29)18-9-8-17(14-19(18)24-23(27)30)21(28)26-11-5-10-25(3)12-13-26/h4,6-9,14H,5,10-13H2,1-3H3,(H,24,30) |
| InChIKey | JTPLAZOSOBLYJS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|