C21H22BrN3O3 — CID 78820897
2-[[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol (PubChem CID 78820897) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 2-[[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2-[[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 78820897 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-[[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CN(Cc1nc(-c2cccc(Br)c2)no1)CC1CCCO1 |
| InChI | InChI=1S/C21H22BrN3O3/c22-17-7-3-6-15(11-17)21-23-20(28-24-21)14-25(13-18-8-4-10-27-18)12-16-5-1-2-9-19(16)26/h1-3,5-7,9,11,18,26H,4,8,10,12-14H2 |
| InChIKey | ZQQUKBZRDVXFPM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|