C22H23F2N3O4 — CID 78821365
2-[[[3-[2-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol (PubChem CID 78821365) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-[[[3-[2-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2-[[[3-[2-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 78821365 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[[[3-[2-(difluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methyl-(oxolan-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CN(Cc1nc(-c2ccccc2OC(F)F)no1)CC1CCCO1 |
| InChI | InChI=1S/C22H23F2N3O4/c23-22(24)30-19-10-4-2-8-17(19)21-25-20(31-26-21)14-27(13-16-7-5-11-29-16)12-15-6-1-3-9-18(15)28/h1-4,6,8-10,16,22,28H,5,7,11-14H2 |
| InChIKey | DPVZQPAPEZRYRF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|