C21H18ClN3O3 — CID 78820943
2-[[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl-(furan-2-ylmethyl)amino]methyl]phenol (PubChem CID 78820943) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-[[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl-(furan-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2-[[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl-(furan-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 78820943 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl-(furan-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CN(Cc1ccco1)Cc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C21H18ClN3O3/c22-17-9-7-15(8-10-17)21-23-20(28-24-21)14-25(13-18-5-3-11-27-18)12-16-4-1-2-6-19(16)26/h1-11,26H,12-14H2 |
| InChIKey | FQYCVAZRWNTZCF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|