C25H25N3O3S — CID 78821284
2-[[(2-hydroxyphenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 78821284) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[[(2-hydroxyphenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[(2-hydroxyphenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78821284 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[[(2-hydroxyphenyl)methyl-(oxolan-2-ylmethyl)amino]methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CN(Cc2ccccc2O)CC2CCCO2)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C25H25N3O3S/c29-21-11-5-4-9-18(21)13-28(14-19-10-6-12-31-19)15-22-26-24(30)23-20(16-32-25(23)27-22)17-7-2-1-3-8-17/h1-5,7-9,11,16,19,29H,6,10,12-15H2,(H,26,27,30) |
| InChIKey | AYQTYYUNQVBAGY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|