C18H21N3O2 — CID 78822968
2-[2-cyanoethyl(furan-2-ylmethyl)amino]-N-(1-phenylethyl)acetamide (PubChem CID 78822968) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[2-cyanoethyl(furan-2-ylmethyl)amino]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[2-cyanoethyl(furan-2-ylmethyl)amino]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 78822968 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-[2-cyanoethyl(furan-2-ylmethyl)amino]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CN(CCC#N)Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c1-15(16-7-3-2-4-8-16)20-18(22)14-21(11-6-10-19)13-17-9-5-12-23-17/h2-5,7-9,12,15H,6,11,13-14H2,1H3,(H,20,22) |
| InChIKey | IBMORQYGKICSBG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |