C27H30N4O2 — CID 78820956
3-[[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-(furan-2-ylmethyl)amino]propanenitrile (PubChem CID 78820956) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-(furan-2-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-(furan-2-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 78820956 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[[2-(4-benzhydrylpiperazin-1-yl)-2-oxoethyl]-(furan-2-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(CC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)Cc1ccco1 |
| InChI | InChI=1S/C27H30N4O2/c28-14-8-15-29(21-25-13-7-20-33-25)22-26(32)30-16-18-31(19-17-30)27(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-7,9-13,20,27H,8,15-19,21-22H2 |
| InChIKey | WZZGMUACRLVODE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |