C18H25N3O4 — CID 78822822
ethyl 1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]acetyl]piperidine-4-carboxylate (PubChem CID 78822822) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl 1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78822822 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | ethyl 1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN(CCC#N)Cc2ccco2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-2-24-18(23)15-6-10-21(11-7-15)17(22)14-20(9-4-8-19)13-16-5-3-12-25-16/h3,5,12,15H,2,4,6-7,9-11,13-14H2,1H3 |
| InChIKey | LKBSBYBHJSHXKE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |