C22H28N2O5 — CID 78821358
ethyl 1-[2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetyl]piperidine-2-carboxylate (PubChem CID 78821358) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl 1-[2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 78821358 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | ethyl 1-[2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)CN(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C22H28N2O5/c1-2-28-22(27)19-10-5-6-12-24(19)21(26)16-23(15-18-9-7-13-29-18)14-17-8-3-4-11-20(17)25/h3-4,7-9,11,13,19,25H,2,5-6,10,12,14-16H2,1H3 |
| InChIKey | QQEDHKFVXFMJDD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|