C20H26N2O5 — CID 55446136
ethyl 1-[2-[bis(furan-2-ylmethyl)amino]acetyl]piperidine-2-carboxylate (PubChem CID 55446136) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 1-[2-[bis(furan-2-ylmethyl)amino]acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-[bis(furan-2-ylmethyl)amino]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 55446136 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | ethyl 1-[2-[bis(furan-2-ylmethyl)amino]acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)CN(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C20H26N2O5/c1-2-25-20(24)18-9-3-4-10-22(18)19(23)15-21(13-16-7-5-11-26-16)14-17-8-6-12-27-17/h5-8,11-12,18H,2-4,9-10,13-15H2,1H3 |
| InChIKey | YIAUHAFAGKSLJS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |