C15H19NO4 — CID 78987166
ethyl 1-[(E)-3-(furan-2-yl)prop-2-enoyl]piperidine-2-carboxylate (PubChem CID 78987166) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl 1-[(E)-3-(furan-2-yl)prop-2-enoyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[(E)-3-(furan-2-yl)prop-2-enoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 78987166 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl 1-[(E)-3-(furan-2-yl)prop-2-enoyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C15H19NO4/c1-2-19-15(18)13-7-3-4-10-16(13)14(17)9-8-12-6-5-11-20-12/h5-6,8-9,11,13H,2-4,7,10H2,1H3/b9-8+ |
| InChIKey | SXLOEBJYHXAELN-CMDGGOBGSA-N |
| XLogP | 2.24 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|