C15H19NO4 — CID 94814678
methyl (2S)-1-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]piperidine-2-carboxylate (PubChem CID 94814678) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl (2S)-1-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 94814678 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | methyl (2S)-1-[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCCN1C(=O)/C=C/c1ccc(C)o1 |
| InChI | InChI=1S/C15H19NO4/c1-11-6-7-12(20-11)8-9-14(17)16-10-4-3-5-13(16)15(18)19-2/h6-9,13H,3-5,10H2,1-2H3/b9-8+/t13-/m0/s1 |
| InChIKey | DSJFOGJVCZKDBA-XEHSLEBBSA-N |
| XLogP | 2.16 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|