C22H26N4O3 — CID 86911076
N-(2-cyclopentylpyrazol-3-yl)-2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetamide (PubChem CID 86911076) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(2-cyclopentylpyrazol-3-yl)-2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetamide.
| Compound Name | N-(2-cyclopentylpyrazol-3-yl)-2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 86911076 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(2-cyclopentylpyrazol-3-yl)-2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]acetamide |
| SMILES | O=C(CN(Cc1ccco1)Cc1ccccc1O)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C22H26N4O3/c27-20-10-4-1-6-17(20)14-25(15-19-9-5-13-29-19)16-22(28)24-21-11-12-23-26(21)18-7-2-3-8-18/h1,4-6,9-13,18,27H,2-3,7-8,14-16H2,(H,24,28) |
| InChIKey | ZMRNCKPZCTZZJO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|