C16H17ClN2O2 — CID 3854860
3-[[2-(3-chlorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]propanenitrile (PubChem CID 3854860) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[[2-(3-chlorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 3854860 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1ccco1)CC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-14-5-1-4-13(10-14)16(20)12-19(8-3-7-18)11-15-6-2-9-21-15/h1-2,4-6,9-10,16,20H,3,8,11-12H2 |
| InChIKey | YJBBJZLQDIAVDQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |