About 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile
3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile (PubChem CID 78793486) has the molecular formula C17H18Cl2N2O3
and a molecular weight of 369.25 g/mol. Its IUPAC name is 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile |
| PubChem CID | 78793486 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1ccco1)CC(O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O3/c18-15-5-1-6-16(19)17(15)24-12-13(22)10-21(8-3-7-20)11-14-4-2-9-23-14/h1-2,4-6,9,13,22H,3,8,10-12H2 |
| InChIKey | BZDFPTIAUNNBKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile?
The IUPAC name of 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile (CID 78793486) is 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile.
What is the SMILES notation for 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile?
The canonical SMILES for 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile is N#CCCN(Cc1ccco1)CC(O)COc1c(Cl)cccc1Cl.
What is the InChIKey of 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile?
The InChIKey is BZDFPTIAUNNBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O3/c18-15-5-1-6-16(19)17(15)24-12-13(22)10-21(8-3-7-20)11-14-4-2-9-23-14/h1-2,4-6,9,13,22H,3,8,10-12H2.
What are the key properties of 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile?
3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile has a molecular weight of 369.25 g/mol, XLogP of 3.74, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-(furan-2-ylmethyl)amino]propanenitrile is sourced from PubChem (CID 78793486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).