C17H20N2O3 — CID 3808741
3-[furan-2-ylmethyl-(2-hydroxy-3-phenoxypropyl)amino]propanenitrile (PubChem CID 3808741) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[furan-2-ylmethyl-(2-hydroxy-3-phenoxypropyl)amino]propanenitrile.
| Compound Name | 3-[furan-2-ylmethyl-(2-hydroxy-3-phenoxypropyl)amino]propanenitrile |
|---|---|
| PubChem CID | 3808741 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-[furan-2-ylmethyl-(2-hydroxy-3-phenoxypropyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1ccco1)CC(O)COc1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c18-9-5-10-19(13-17-8-4-11-21-17)12-15(20)14-22-16-6-2-1-3-7-16/h1-4,6-8,11,15,20H,5,10,12-14H2 |
| InChIKey | GXIWWKCMUYUVET-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |