C12H19N5O2 — CID 78826448
2-[[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-methylamino]-N-methylacetamide (PubChem CID 78826448) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-methylamino]-N-methylacetamide.
| Compound Name | 2-[[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 78826448 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)CC(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C12H19N5O2/c1-15-11(18)9-16(2)10-12(19)17(7-3-5-13)8-4-6-14/h3-4,7-10H2,1-2H3,(H,15,18) |
| InChIKey | JKBFBTFBZLTSNU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |