C18H16FN3O3S2 — CID 78828075
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 78828075) has the molecular formula C18H16FN3O3S2 and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,4-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,4-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 78828075 |
| Molecular Formula | C18H16FN3O3S2 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2nc(-c3ccc(F)cc3)cs2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C18H16FN3O3S2/c1-10-7-13(8-16(11(10)2)27(20,24)25)17(23)22-18-21-15(9-26-18)12-3-5-14(19)6-4-12/h3-9H,1-2H3,(H2,20,24,25)(H,21,22,23) |
| InChIKey | RDJDQPHOKZVBIO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |