C18H17NO6S — CID 7883044
(4-oxo-4-thiophen-2-ylbutyl) 2-(1,3-benzodioxole-5-carbonylamino)acetate (PubChem CID 7883044) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 2-(1,3-benzodioxole-5-carbonylamino)acetate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 2-(1,3-benzodioxole-5-carbonylamino)acetate |
|---|---|
| PubChem CID | 7883044 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 2-(1,3-benzodioxole-5-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1ccc2c(c1)OCO2)OCCCC(=O)c1cccs1 |
| InChI | InChI=1S/C18H17NO6S/c20-13(16-4-2-8-26-16)3-1-7-23-17(21)10-19-18(22)12-5-6-14-15(9-12)25-11-24-14/h2,4-6,8-9H,1,3,7,10-11H2,(H,19,22) |
| InChIKey | BRLXIJYZLSYOPX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|