C23H25N5O3 — CID 78831536
N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 78831536) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 78831536 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CC1Oc2ccccc2N(CC(=O)Nc2ccnn2Cc2ccc(N(C)C)cc2)C1=O |
| InChI | InChI=1S/C23H25N5O3/c1-16-23(30)27(19-6-4-5-7-20(19)31-16)15-22(29)25-21-12-13-24-28(21)14-17-8-10-18(11-9-17)26(2)3/h4-13,16H,14-15H2,1-3H3,(H,25,29) |
| InChIKey | XLTCTPYLPPUHFS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|