C21H19N5O — CID 78832324
1-naphthalen-2-yl-3-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]urea (PubChem CID 78832324) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-naphthalen-2-yl-3-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-naphthalen-2-yl-3-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78832324 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-naphthalen-2-yl-3-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(Cn2cncn2)cc1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19N5O/c27-21(25-20-10-9-18-3-1-2-4-19(18)11-20)23-12-16-5-7-17(8-6-16)13-26-15-22-14-24-26/h1-11,14-15H,12-13H2,(H2,23,25,27) |
| InChIKey | GFMLOPNZEKQHFQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |