C14H13FO3S — CID 78832390
2-methylsulfanylethyl 5-(2-fluorophenyl)furan-2-carboxylate (PubChem CID 78832390) has the molecular formula C14H13FO3S and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-methylsulfanylethyl 5-(2-fluorophenyl)furan-2-carboxylate.
| Compound Name | 2-methylsulfanylethyl 5-(2-fluorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 78832390 |
| Molecular Formula | C14H13FO3S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-methylsulfanylethyl 5-(2-fluorophenyl)furan-2-carboxylate |
| SMILES | CSCCOC(=O)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C14H13FO3S/c1-19-9-8-17-14(16)13-7-6-12(18-13)10-4-2-3-5-11(10)15/h2-7H,8-9H2,1H3 |
| InChIKey | OTAPKDYSTNVNSA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|