C18H19FN2O5 — CID 8666009
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 5-(2-fluorophenyl)furan-2-carboxylate (PubChem CID 8666009) has the molecular formula C18H19FN2O5 and a molecular weight of 362.36 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 5-(2-fluorophenyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 5-(2-fluorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 8666009 |
| Molecular Formula | C18H19FN2O5 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 5-(2-fluorophenyl)furan-2-carboxylate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C18H19FN2O5/c1-2-9-20-16(22)10-21-17(23)11-25-18(24)15-8-7-14(26-15)12-5-3-4-6-13(12)19/h3-8H,2,9-11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BWRARKKFZPDTJC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |