C20H29NO4 — CID 78835716
(2-ethylcyclohexyl) 3-acetamido-3-(4-methoxyphenyl)propanoate (PubChem CID 78835716) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 3-acetamido-3-(4-methoxyphenyl)propanoate.
| Compound Name | (2-ethylcyclohexyl) 3-acetamido-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 78835716 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (2-ethylcyclohexyl) 3-acetamido-3-(4-methoxyphenyl)propanoate |
| SMILES | CCC1CCCCC1OC(=O)CC(NC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H29NO4/c1-4-15-7-5-6-8-19(15)25-20(23)13-18(21-14(2)22)16-9-11-17(24-3)12-10-16/h9-12,15,18-19H,4-8,13H2,1-3H3,(H,21,22) |
| InChIKey | SFNZCNSLGJAXFP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |