C11H17Cl2NO — CID 78836724
2,2-dichloro-N-(cyclopropylmethyl)-N-propylcyclopropane-1-carboxamide (PubChem CID 78836724) has the molecular formula C11H17Cl2NO and a molecular weight of 250.17 g/mol. Its IUPAC name is 2,2-dichloro-N-(cyclopropylmethyl)-N-propylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(cyclopropylmethyl)-N-propylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78836724 |
| Molecular Formula | C11H17Cl2NO |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2,2-dichloro-N-(cyclopropylmethyl)-N-propylcyclopropane-1-carboxamide |
| SMILES | CCCN(CC1CC1)C(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C11H17Cl2NO/c1-2-5-14(7-8-3-4-8)10(15)9-6-11(9,12)13/h8-9H,2-7H2,1H3 |
| InChIKey | XSDIGPHWZYYPFW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|