C10H14Cl2F3NO — CID 78868725
N-butyl-2,2-dichloro-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide (PubChem CID 78868725) has the molecular formula C10H14Cl2F3NO and a molecular weight of 292.13 g/mol. Its IUPAC name is N-butyl-2,2-dichloro-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide.
| Compound Name | N-butyl-2,2-dichloro-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78868725 |
| Molecular Formula | C10H14Cl2F3NO |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-butyl-2,2-dichloro-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C10H14Cl2F3NO/c1-2-3-4-16(6-10(13,14)15)8(17)7-5-9(7,11)12/h7H,2-6H2,1H3 |
| InChIKey | AMJFKMIXLOJGGT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|