C16H16BrNO5 — CID 7883797
2-(4-methylphenoxy)ethyl 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 7883797) has the molecular formula C16H16BrNO5 and a molecular weight of 382.21 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | 2-(4-methylphenoxy)ethyl 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 7883797 |
| Molecular Formula | C16H16BrNO5 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | Cc1ccc(OCCOC(=O)CNC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C16H16BrNO5/c1-11-2-4-12(5-3-11)21-8-9-22-15(19)10-18-16(20)13-6-7-14(17)23-13/h2-7H,8-10H2,1H3,(H,18,20) |
| InChIKey | HSIXLSINZHPORY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|