C21H24ClN3O2 — CID 78838219
1-(4-chlorobenzoyl)-N-(2,4,6-trimethyl-3-pyridinyl)piperidine-3-carboxamide (PubChem CID 78838219) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-(2,4,6-trimethyl-3-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-(2,4,6-trimethyl-3-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 78838219 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-(2,4,6-trimethyl-3-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CCCN(C(=O)c3ccc(Cl)cc3)C2)c(C)n1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-13-11-14(2)23-15(3)19(13)24-20(26)17-5-4-10-25(12-17)21(27)16-6-8-18(22)9-7-16/h6-9,11,17H,4-5,10,12H2,1-3H3,(H,24,26) |
| InChIKey | NVTFEDJCIWRYCG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |