C16H17FN4OS — CID 78838929
1-(2-cyano-4-fluorophenyl)-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea (PubChem CID 78838929) has the molecular formula C16H17FN4OS and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 78838929 |
| Molecular Formula | C16H17FN4OS |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-[2-(dimethylamino)-2-thiophen-2-ylethyl]urea |
| SMILES | CN(C)C(CNC(=O)Nc1ccc(F)cc1C#N)c1cccs1 |
| InChI | InChI=1S/C16H17FN4OS/c1-21(2)14(15-4-3-7-23-15)10-19-16(22)20-13-6-5-12(17)8-11(13)9-18/h3-8,14H,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | AGKHMCXFYWKHFI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |