C18H18N4O3S — CID 78840085
N-methyl-4-oxo-3-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]phthalazine-1-carboxamide (PubChem CID 78840085) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-methyl-4-oxo-3-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]phthalazine-1-carboxamide.
| Compound Name | N-methyl-4-oxo-3-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 78840085 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-methyl-4-oxo-3-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]phthalazine-1-carboxamide |
| SMILES | CNC(=O)c1nn(CC(=O)NC(C)c2cccs2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H18N4O3S/c1-11(14-8-5-9-26-14)20-15(23)10-22-18(25)13-7-4-3-6-12(13)16(21-22)17(24)19-2/h3-9,11H,10H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | KOQPVOPNPJCAPB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |