C20H22F2N2O3S — CID 78844555
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 78844555) has the molecular formula C20H22F2N2O3S and a molecular weight of 408.47 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78844555 |
| Molecular Formula | C20H22F2N2O3S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(OC(F)F)cc1)C1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H22F2N2O3S/c21-20(22)27-15-8-6-14(7-9-15)10-11-23-18(25)16-4-1-2-12-24(16)19(26)17-5-3-13-28-17/h3,5-9,13,16,20H,1-2,4,10-12H2,(H,23,25) |
| InChIKey | YABOHBLOUUJYSS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |