C20H21F3N2O3S — CID 78882058
1-(thiophene-2-carbonyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-2-carboxamide (PubChem CID 78882058) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is 1-(thiophene-2-carbonyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-2-carboxamide.
| Compound Name | 1-(thiophene-2-carbonyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 78882058 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-(thiophene-2-carbonyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(OC(F)(F)F)cc1)C1CCCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H21F3N2O3S/c21-20(22,23)28-15-8-6-14(7-9-15)10-11-24-18(26)16-4-1-2-12-25(16)19(27)17-5-3-13-29-17/h3,5-9,13,16H,1-2,4,10-12H2,(H,24,26) |
| InChIKey | QSKBXIOHVMYUMM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |