methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate

C18H12F2N2O3 — CID 78845060

IUPACmethyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate
SMILESCOC(=O)c1cc(NC(=O)c2ccnc3ccccc23)c(F)cc1F
InChIInChI=1S/C18H12F2N2O3/c1-25-18(24)12-8-16(14(20)9-13(12)19)22-17(23)11-6-7-21-15-5-3-2-4-10(11)15/h2-9H,1H3,(H,22,23)
InChIKeyPZAMCHFJXWTFTC-UHFFFAOYSA-N
MW342.30 g/mol
LogP3.55
Rot. Bonds3

About methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate

methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate (PubChem CID 78845060) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate.

Molecular Properties

Compound Namemethyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate
PubChem CID78845060
Molecular FormulaC18H12F2N2O3
Molecular Weight342.30 g/mol
Exact Mass342.08
IUPAC Namemethyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate
SMILESCOC(=O)c1cc(NC(=O)c2ccnc3ccccc23)c(F)cc1F
InChIInChI=1S/C18H12F2N2O3/c1-25-18(24)12-8-16(14(20)9-13(12)19)22-17(23)11-6-7-21-15-5-3-2-4-10(11)15/h2-9H,1H3,(H,22,23)
InChIKeyPZAMCHFJXWTFTC-UHFFFAOYSA-N
XLogP3.55
TPSA68.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.30
LogP ≤ 53.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate?
The IUPAC name of methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate (CID 78845060) is methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate.
What is the SMILES notation for methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate?
The canonical SMILES for methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate is COC(=O)c1cc(NC(=O)c2ccnc3ccccc23)c(F)cc1F.
What is the InChIKey of methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate?
The InChIKey is PZAMCHFJXWTFTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2N2O3/c1-25-18(24)12-8-16(14(20)9-13(12)19)22-17(23)11-6-7-21-15-5-3-2-4-10(11)15/h2-9H,1H3,(H,22,23).
What are the key properties of methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate?
methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate has a molecular weight of 342.30 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-difluoro-5-(quinoline-4-carbonylamino)benzoate is sourced from PubChem (CID 78845060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).