C18H21NO4S2 — CID 78845702
(2,3-dimethylphenyl) 1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 78845702) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (2,3-dimethylphenyl) 1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2,3-dimethylphenyl) 1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 78845702 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (2,3-dimethylphenyl) 1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Oc2cccc(C)c2C)s1 |
| InChI | InChI=1S/C18H21NO4S2/c1-12-6-4-8-16(14(12)3)23-18(20)15-7-5-11-19(15)25(21,22)17-10-9-13(2)24-17/h4,6,8-10,15H,5,7,11H2,1-3H3 |
| InChIKey | QDCBSOINMIADDR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|