C22H31N5O2 — CID 78845819
N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-(2-methylpropanoyl)piperidine-4-carboxamide (PubChem CID 78845819) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-(2-methylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78845819 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-1-(2-methylpropanoyl)piperidine-4-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(C(=O)Nc2ccnn2Cc2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H31N5O2/c1-16(2)22(29)26-13-10-18(11-14-26)21(28)24-20-9-12-23-27(20)15-17-5-7-19(8-6-17)25(3)4/h5-9,12,16,18H,10-11,13-15H2,1-4H3,(H,24,28) |
| InChIKey | LISBTVWSRLVNKO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|